C21H25FN2O4S — CID 144729253
4-[[3-fluoro-4-(4-methoxyphenyl)phenyl]methylamino]-N-hydroxy-1-methylidene-1-oxothiane-4-carboxamide (PubChem CID 144729253) has the molecular formula C21H25FN2O4S and a molecular weight of 420.51 g/mol. Its IUPAC name is 4-[[3-fluoro-4-(4-methoxyphenyl)phenyl]methylamino]-N-hydroxy-1-methylidene-1-oxothiane-4-carboxamide.
| Compound Name | 4-[[3-fluoro-4-(4-methoxyphenyl)phenyl]methylamino]-N-hydroxy-1-methylidene-1-oxothiane-4-carboxamide |
|---|---|
| PubChem CID | 144729253 |
| Molecular Formula | C21H25FN2O4S |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 4-[[3-fluoro-4-(4-methoxyphenyl)phenyl]methylamino]-N-hydroxy-1-methylidene-1-oxothiane-4-carboxamide |
| SMILES | C=S1(=O)CCC(NCc2ccc(-c3ccc(OC)cc3)c(F)c2)(C(=O)NO)CC1 |
| InChI | InChI=1S/C21H25FN2O4S/c1-28-17-6-4-16(5-7-17)18-8-3-15(13-19(18)22)14-23-21(20(25)24-26)9-11-29(2,27)12-10-21/h3-8,13,23,26H,2,9-12,14H2,1H3,(H,24,25) |
| InChIKey | UAYGAXOQARMZSW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|