C19H20ClFN2O4S — CID 86275591
4-[[4-(4-chloro-2-fluorophenyl)phenyl]methylamino]-N-hydroxy-1,1-dioxothiane-4-carboxamide (PubChem CID 86275591) has the molecular formula C19H20ClFN2O4S and a molecular weight of 426.90 g/mol. Its IUPAC name is 4-[[4-(4-chloro-2-fluorophenyl)phenyl]methylamino]-N-hydroxy-1,1-dioxothiane-4-carboxamide.
| Compound Name | 4-[[4-(4-chloro-2-fluorophenyl)phenyl]methylamino]-N-hydroxy-1,1-dioxothiane-4-carboxamide |
|---|---|
| PubChem CID | 86275591 |
| Molecular Formula | C19H20ClFN2O4S |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 4-[[4-(4-chloro-2-fluorophenyl)phenyl]methylamino]-N-hydroxy-1,1-dioxothiane-4-carboxamide |
| SMILES | O=C(NO)C1(NCc2ccc(-c3ccc(Cl)cc3F)cc2)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C19H20ClFN2O4S/c20-15-5-6-16(17(21)11-15)14-3-1-13(2-4-14)12-22-19(18(24)23-25)7-9-28(26,27)10-8-19/h1-6,11,22,25H,7-10,12H2,(H,23,24) |
| InChIKey | KIWFCHQGOWCLKA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|