C22H27FN2O3S — CID 123590306
4-[[4-(2-fluoro-4-methoxyphenyl)phenyl]methylamino]-N-hydroxy-1,1-dimethylidenethiane-4-carboxamide (PubChem CID 123590306) has the molecular formula C22H27FN2O3S and a molecular weight of 418.53 g/mol. Its IUPAC name is 4-[[4-(2-fluoro-4-methoxyphenyl)phenyl]methylamino]-N-hydroxy-1,1-dimethylidenethiane-4-carboxamide.
| Compound Name | 4-[[4-(2-fluoro-4-methoxyphenyl)phenyl]methylamino]-N-hydroxy-1,1-dimethylidenethiane-4-carboxamide |
|---|---|
| PubChem CID | 123590306 |
| Molecular Formula | C22H27FN2O3S |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 4-[[4-(2-fluoro-4-methoxyphenyl)phenyl]methylamino]-N-hydroxy-1,1-dimethylidenethiane-4-carboxamide |
| SMILES | C=S1(=C)CCC(NCc2ccc(-c3ccc(OC)cc3F)cc2)(C(=O)NO)CC1 |
| InChI | InChI=1S/C22H27FN2O3S/c1-28-18-8-9-19(20(23)14-18)17-6-4-16(5-7-17)15-24-22(21(26)25-27)10-12-29(2,3)13-11-22/h4-9,14,24,27H,2-3,10-13,15H2,1H3,(H,25,26) |
| InChIKey | VCFOAGWKOFHSNO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|