C23H27FO4 — CID 144983586
2-fluoro-4-methoxy-1-[4-(2-methoxyethyl)phenyl]benzene;2-methylprop-2-enal;prop-2-enal (PubChem CID 144983586) has the molecular formula C23H27FO4 and a molecular weight of 386.46 g/mol. Its IUPAC name is 2-fluoro-4-methoxy-1-[4-(2-methoxyethyl)phenyl]benzene;2-methylprop-2-enal;prop-2-enal.
| Compound Name | 2-fluoro-4-methoxy-1-[4-(2-methoxyethyl)phenyl]benzene;2-methylprop-2-enal;prop-2-enal |
|---|---|
| PubChem CID | 144983586 |
| Molecular Formula | C23H27FO4 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 2-fluoro-4-methoxy-1-[4-(2-methoxyethyl)phenyl]benzene;2-methylprop-2-enal;prop-2-enal |
| SMILES | C=C(C)C=O.C=CC=O.COCCc1ccc(-c2ccc(OC)cc2F)cc1 |
| InChI | InChI=1S/C16H17FO2.C4H6O.C3H4O/c1-18-10-9-12-3-5-13(6-4-12)15-8-7-14(19-2)11-16(15)17;1-4(2)3-5;1-2-3-4/h3-8,11H,9-10H2,1-2H3;3H,1H2,2H3;2-3H,1H2 |
| InChIKey | AMAIZNPCTDBJQO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|