C44H47FO9 — CID 145097161
6-[4-[2-fluoro-4-[(E)-3-oxoprop-1-enyl]phenyl]phenoxy]hexyl prop-2-enoate;2-methoxyethyl 4-(4-methoxyphenyl)benzoate;prop-2-enal (PubChem CID 145097161) has the molecular formula C44H47FO9 and a molecular weight of 738.85 g/mol. Its IUPAC name is 6-[4-[2-fluoro-4-[(E)-3-oxoprop-1-enyl]phenyl]phenoxy]hexyl prop-2-enoate;2-methoxyethyl 4-(4-methoxyphenyl)benzoate;prop-2-enal.
| Compound Name | 6-[4-[2-fluoro-4-[(E)-3-oxoprop-1-enyl]phenyl]phenoxy]hexyl prop-2-enoate;2-methoxyethyl 4-(4-methoxyphenyl)benzoate;prop-2-enal |
|---|---|
| PubChem CID | 145097161 |
| Molecular Formula | C44H47FO9 |
| Molecular Weight | 738.85 g/mol |
| Exact Mass | 738.32 |
| IUPAC Name | 6-[4-[2-fluoro-4-[(E)-3-oxoprop-1-enyl]phenyl]phenoxy]hexyl prop-2-enoate;2-methoxyethyl 4-(4-methoxyphenyl)benzoate;prop-2-enal |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(-c2ccc(/C=C/C=O)cc2F)cc1.C=CC=O.COCCOC(=O)c1ccc(-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H25FO4.C17H18O4.C3H4O/c1-2-24(27)29-17-6-4-3-5-16-28-21-12-10-20(11-13-21)22-14-9-19(8-7-15-26)18-23(22)25;1-19-11-12-21-17(18)15-5-3-13(4-6-15)14-7-9-16(20-2)10-8-14;1-2-3-4/h2,7-15,18H,1,3-6,16-17H2;3-10H,11-12H2,1-2H3;2-3H,1H2/b8-7+;; |
| InChIKey | JNFIAGOFSMVLLN-MIIBGCIDSA-N |
| XLogP | 8.91 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.85 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|