C41H50O6P2 — CID 145389642
1,4-dimethoxybenzene;(E)-3-[4-[4-[4-(6-methoxyhexoxy)phenyl]-3-methylphosphanylphenyl]-3-methylphosphanylphenyl]prop-2-enal;prop-2-enal (PubChem CID 145389642) has the molecular formula C41H50O6P2 and a molecular weight of 700.79 g/mol. Its IUPAC name is 1,4-dimethoxybenzene;(E)-3-[4-[4-[4-(6-methoxyhexoxy)phenyl]-3-methylphosphanylphenyl]-3-methylphosphanylphenyl]prop-2-enal;prop-2-enal.
| Compound Name | 1,4-dimethoxybenzene;(E)-3-[4-[4-[4-(6-methoxyhexoxy)phenyl]-3-methylphosphanylphenyl]-3-methylphosphanylphenyl]prop-2-enal;prop-2-enal |
|---|---|
| PubChem CID | 145389642 |
| Molecular Formula | C41H50O6P2 |
| Molecular Weight | 700.79 g/mol |
| Exact Mass | 700.31 |
| IUPAC Name | 1,4-dimethoxybenzene;(E)-3-[4-[4-[4-(6-methoxyhexoxy)phenyl]-3-methylphosphanylphenyl]-3-methylphosphanylphenyl]prop-2-enal;prop-2-enal |
| SMILES | C=CC=O.COCCCCCCOc1ccc(-c2ccc(-c3ccc(/C=C/C=O)cc3PC)cc2PC)cc1.COc1ccc(OC)cc1 |
| InChI | InChI=1S/C30H36O3P2.C8H10O2.C3H4O/c1-32-19-6-4-5-7-20-33-26-14-11-24(12-15-26)27-17-13-25(22-30(27)35-3)28-16-10-23(9-8-18-31)21-29(28)34-2;1-9-7-3-5-8(10-2)6-4-7;1-2-3-4/h8-18,21-22,34-35H,4-7,19-20H2,1-3H3;3-6H,1-2H3;2-3H,1H2/b9-8+;; |
| InChIKey | YBKCDCCVMNRSQK-YEUQMBKVSA-N |
| XLogP | 8.76 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.79 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|