C8H13N3 — CID 144729427
N-[(4-methyl-1,2,3,6-tetrahydropyridin-5-yl)methylidene]methanimidamide (PubChem CID 144729427) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is N-[(4-methyl-1,2,3,6-tetrahydropyridin-5-yl)methylidene]methanimidamide.
| Compound Name | N-[(4-methyl-1,2,3,6-tetrahydropyridin-5-yl)methylidene]methanimidamide |
|---|---|
| PubChem CID | 144729427 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | N-[(4-methyl-1,2,3,6-tetrahydropyridin-5-yl)methylidene]methanimidamide |
| SMILES | [H]/N=C/N=C/C1=C(C)CCNC1 |
| InChI | InChI=1S/C8H13N3/c1-7-2-3-10-4-8(7)5-11-6-9/h5-6,9-10H,2-4H2,1H3/b9-6+,11-5+ |
| InChIKey | BMLAMADCRIQGMH-XIPKQYMXSA-N |
| XLogP | 0.97 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|