C21H36O4S — CID 144732238
10a-ethyl-8,8-dimethyl-2-methylidene-3,4,4a,4b,5,6,7,8a,9,10-decahydrophenanthren-1-one;dimethyl sulfite (PubChem CID 144732238) has the molecular formula C21H36O4S and a molecular weight of 384.58 g/mol. Its IUPAC name is 10a-ethyl-8,8-dimethyl-2-methylidene-3,4,4a,4b,5,6,7,8a,9,10-decahydrophenanthren-1-one;dimethyl sulfite.
| Compound Name | 10a-ethyl-8,8-dimethyl-2-methylidene-3,4,4a,4b,5,6,7,8a,9,10-decahydrophenanthren-1-one;dimethyl sulfite |
|---|---|
| PubChem CID | 144732238 |
| Molecular Formula | C21H36O4S |
| Molecular Weight | 384.58 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 10a-ethyl-8,8-dimethyl-2-methylidene-3,4,4a,4b,5,6,7,8a,9,10-decahydrophenanthren-1-one;dimethyl sulfite |
| SMILES | C=C1CCC2C3CCCC(C)(C)C3CCC2(CC)C1=O.COS(=O)OC |
| InChI | InChI=1S/C19H30O.C2H6O3S/c1-5-19-12-10-15-14(7-6-11-18(15,3)4)16(19)9-8-13(2)17(19)20;1-4-6(3)5-2/h14-16H,2,5-12H2,1,3-4H3;1-2H3 |
| InChIKey | BVPBDHIOKKGXHJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|