C18H26O2 — CID 144732267
2-(1-methyl-7-methylidene-8-oxo-3,4,4a,4b,5,6,8a,9,10,10a-decahydro-2H-phenanthren-1-yl)acetaldehyde (PubChem CID 144732267) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 2-(1-methyl-7-methylidene-8-oxo-3,4,4a,4b,5,6,8a,9,10,10a-decahydro-2H-phenanthren-1-yl)acetaldehyde.
| Compound Name | 2-(1-methyl-7-methylidene-8-oxo-3,4,4a,4b,5,6,8a,9,10,10a-decahydro-2H-phenanthren-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 144732267 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 2-(1-methyl-7-methylidene-8-oxo-3,4,4a,4b,5,6,8a,9,10,10a-decahydro-2H-phenanthren-1-yl)acetaldehyde |
| SMILES | C=C1CCC2C(CCC3C2CCCC3(C)CC=O)C1=O |
| InChI | InChI=1S/C18H26O2/c1-12-5-6-13-14-4-3-9-18(2,10-11-19)16(14)8-7-15(13)17(12)20/h11,13-16H,1,3-10H2,2H3 |
| InChIKey | JIFWTQVAVJOBKT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|