C20H47N7O4 — CID 144733199
5-amino-2-[(2-aminoacetyl)amino]-N-ethylpentanamide;6-amino-2-formamidohexanamide;ethane (PubChem CID 144733199) has the molecular formula C20H47N7O4 and a molecular weight of 449.64 g/mol. Its IUPAC name is 5-amino-2-[(2-aminoacetyl)amino]-N-ethylpentanamide;6-amino-2-formamidohexanamide;ethane.
| Compound Name | 5-amino-2-[(2-aminoacetyl)amino]-N-ethylpentanamide;6-amino-2-formamidohexanamide;ethane |
|---|---|
| PubChem CID | 144733199 |
| Molecular Formula | C20H47N7O4 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.37 |
| IUPAC Name | 5-amino-2-[(2-aminoacetyl)amino]-N-ethylpentanamide;6-amino-2-formamidohexanamide;ethane |
| SMILES | CC.CC.CCNC(=O)C(CCCN)NC(=O)CN.NCCCCC(NC=O)C(N)=O |
| InChI | InChI=1S/C9H20N4O2.C7H15N3O2.2C2H6/c1-2-12-9(15)7(4-3-5-10)13-8(14)6-11;8-4-2-1-3-6(7(9)12)10-5-11;2*1-2/h7H,2-6,10-11H2,1H3,(H,12,15)(H,13,14);5-6H,1-4,8H2,(H2,9,12)(H,10,11);2*1-2H3 |
| InChIKey | QKDHHUYKCJGWNJ-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 208.45 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|