C17H19F3O — CID 144733836
ethane;4,5,6-trifluoro-3,7-dimethyl-2,9-dihydro-1H-xanthene (PubChem CID 144733836) has the molecular formula C17H19F3O and a molecular weight of 296.33 g/mol. Its IUPAC name is ethane;4,5,6-trifluoro-3,7-dimethyl-2,9-dihydro-1H-xanthene.
| Compound Name | ethane;4,5,6-trifluoro-3,7-dimethyl-2,9-dihydro-1H-xanthene |
|---|---|
| PubChem CID | 144733836 |
| Molecular Formula | C17H19F3O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | ethane;4,5,6-trifluoro-3,7-dimethyl-2,9-dihydro-1H-xanthene |
| SMILES | CC.CC1=C(F)C2=C(CC1)Cc1cc(C)c(F)c(F)c1O2 |
| InChI | InChI=1S/C15H13F3O.C2H6/c1-7-3-4-9-6-10-5-8(2)11(16)13(18)15(10)19-14(9)12(7)17;1-2/h5H,3-4,6H2,1-2H3;1-2H3 |
| InChIKey | YIAVOLLDRMVZAB-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |