C18H28N2O2S — CID 144736305
N-[(1Z)-2-methyl-1-(methylideneamino)buta-1,3-dienyl]-2-propan-2-ylsulfonylaniline;propane (PubChem CID 144736305) has the molecular formula C18H28N2O2S and a molecular weight of 336.50 g/mol. Its IUPAC name is N-[(1Z)-2-methyl-1-(methylideneamino)buta-1,3-dienyl]-2-propan-2-ylsulfonylaniline;propane.
| Compound Name | N-[(1Z)-2-methyl-1-(methylideneamino)buta-1,3-dienyl]-2-propan-2-ylsulfonylaniline;propane |
|---|---|
| PubChem CID | 144736305 |
| Molecular Formula | C18H28N2O2S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | N-[(1Z)-2-methyl-1-(methylideneamino)buta-1,3-dienyl]-2-propan-2-ylsulfonylaniline;propane |
| SMILES | C=C/C(C)=C(\N=C)Nc1ccccc1S(=O)(=O)C(C)C.CCC |
| InChI | InChI=1S/C15H20N2O2S.C3H8/c1-6-12(4)15(16-5)17-13-9-7-8-10-14(13)20(18,19)11(2)3;1-3-2/h6-11,17H,1,5H2,2-4H3;3H2,1-2H3/b15-12+; |
| InChIKey | PNWMBVVZALGQNE-JRUHLWALSA-N |
| XLogP | 4.82 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|