C9H17N3 — CID 144740191
(E)-4-methylimino-4-pyrrolidin-3-ylbut-2-en-2-amine (PubChem CID 144740191) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is (E)-4-methylimino-4-pyrrolidin-3-ylbut-2-en-2-amine.
| Compound Name | (E)-4-methylimino-4-pyrrolidin-3-ylbut-2-en-2-amine |
|---|---|
| PubChem CID | 144740191 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | (E)-4-methylimino-4-pyrrolidin-3-ylbut-2-en-2-amine |
| SMILES | C/N=C(\C=C(/C)N)C1CCNC1 |
| InChI | InChI=1S/C9H17N3/c1-7(10)5-9(11-2)8-3-4-12-6-8/h5,8,12H,3-4,6,10H2,1-2H3/b7-5+,11-9+ |
| InChIKey | OLIWXFOZPRDXFU-JEGFTUTRSA-N |
| XLogP | 0.53 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|