C11H16N2S — CID 5375878
4,4-dimethyl-5-[(E)-pyrrolidin-2-ylidenemethyl]-3H-pyrrole-2-thione (PubChem CID 5375878) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is 4,4-dimethyl-5-[(E)-pyrrolidin-2-ylidenemethyl]-3H-pyrrole-2-thione.
| Compound Name | 4,4-dimethyl-5-[(E)-pyrrolidin-2-ylidenemethyl]-3H-pyrrole-2-thione |
|---|---|
| PubChem CID | 5375878 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 4,4-dimethyl-5-[(E)-pyrrolidin-2-ylidenemethyl]-3H-pyrrole-2-thione |
| SMILES | CC1(C)CC(=S)N=C1/C=C1\CCCN1 |
| InChI | InChI=1S/C11H16N2S/c1-11(2)7-10(14)13-9(11)6-8-4-3-5-12-8/h6,12H,3-5,7H2,1-2H3/b8-6+ |
| InChIKey | YXAWNJLZLZWRQA-SOFGYWHQSA-N |
| XLogP | 2.45 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|