C12H21N2+ — CID 7062678
5,5-dimethyl-3-pyrrolidin-1-ium-1-ylcyclohex-2-en-1-imine (PubChem CID 7062678) has the molecular formula C12H21N2+ and a molecular weight of 193.31 g/mol. Its IUPAC name is 5,5-dimethyl-3-pyrrolidin-1-ium-1-ylcyclohex-2-en-1-imine.
| Compound Name | 5,5-dimethyl-3-pyrrolidin-1-ium-1-ylcyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 7062678 |
| Molecular Formula | C12H21N2+ |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.17 |
| IUPAC Name | 5,5-dimethyl-3-pyrrolidin-1-ium-1-ylcyclohex-2-en-1-imine |
| SMILES | [H]/N=C1/C=C([NH+]2CCCC2)CC(C)(C)C1 |
| InChI | InChI=1S/C12H20N2/c1-12(2)8-10(13)7-11(9-12)14-5-3-4-6-14/h7,13H,3-6,8-9H2,1-2H3/p+1/b13-10- |
| InChIKey | WPDZEDPWVIYOFR-RAXLEYEMSA-O |
| XLogP | 1.39 |
| TPSA | 28.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|