C27H28N4O3 — CID 144744240
[2-(cyclopropylmethylamino)-4-(3,5-dimethyl-1,2-oxazol-4-yl)-6-(2-oxo-1H-quinolin-5-yl)phenyl] cyanate;ethane (PubChem CID 144744240) has the molecular formula C27H28N4O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is [2-(cyclopropylmethylamino)-4-(3,5-dimethyl-1,2-oxazol-4-yl)-6-(2-oxo-1H-quinolin-5-yl)phenyl] cyanate;ethane.
| Compound Name | [2-(cyclopropylmethylamino)-4-(3,5-dimethyl-1,2-oxazol-4-yl)-6-(2-oxo-1H-quinolin-5-yl)phenyl] cyanate;ethane |
|---|---|
| PubChem CID | 144744240 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | [2-(cyclopropylmethylamino)-4-(3,5-dimethyl-1,2-oxazol-4-yl)-6-(2-oxo-1H-quinolin-5-yl)phenyl] cyanate;ethane |
| SMILES | CC.Cc1noc(C)c1-c1cc(NCC2CC2)c(OC#N)c(-c2cccc3[nH]c(=O)ccc23)c1 |
| InChI | InChI=1S/C25H22N4O3.C2H6/c1-14-24(15(2)32-29-14)17-10-20(18-4-3-5-21-19(18)8-9-23(30)28-21)25(31-13-26)22(11-17)27-12-16-6-7-16;1-2/h3-5,8-11,16,27H,6-7,12H2,1-2H3,(H,28,30);1-2H3 |
| InChIKey | QGQUTYAEQOHNMH-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|