C16H24 — CID 144749402
acetylene;3-ethynyl-7,7-dimethyl-2-propylbicyclo[4.1.0]heptane (PubChem CID 144749402) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is acetylene;3-ethynyl-7,7-dimethyl-2-propylbicyclo[4.1.0]heptane.
| Compound Name | acetylene;3-ethynyl-7,7-dimethyl-2-propylbicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 144749402 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | acetylene;3-ethynyl-7,7-dimethyl-2-propylbicyclo[4.1.0]heptane |
| SMILES | C#C.C#CC1CCC2C(C1CCC)C2(C)C |
| InChI | InChI=1S/C14H22.C2H2/c1-5-7-11-10(6-2)8-9-12-13(11)14(12,3)4;1-2/h2,10-13H,5,7-9H2,1,3-4H3;1-2H |
| InChIKey | GMXGIPZUQIEQDS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|