C25H26N6 — CID 144751732
(2E,3E)-2-[[5-(1-piperidin-4-ylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methylidene]-3-[(Z)-prop-1-enyl]hexa-3,5-dienenitrile (PubChem CID 144751732) has the molecular formula C25H26N6 and a molecular weight of 410.53 g/mol. Its IUPAC name is (2E,3E)-2-[[5-(1-piperidin-4-ylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methylidene]-3-[(Z)-prop-1-enyl]hexa-3,5-dienenitrile.
| Compound Name | (2E,3E)-2-[[5-(1-piperidin-4-ylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methylidene]-3-[(Z)-prop-1-enyl]hexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 144751732 |
| Molecular Formula | C25H26N6 |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | (2E,3E)-2-[[5-(1-piperidin-4-ylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methylidene]-3-[(Z)-prop-1-enyl]hexa-3,5-dienenitrile |
| SMILES | C=C/C=C(\C=C/C)C(/C#N)=C\c1c[nH]c2ncc(-c3cnn(C4CCNCC4)c3)cc12 |
| InChI | InChI=1S/C25H26N6/c1-3-5-18(6-4-2)19(13-26)11-21-15-29-25-24(21)12-20(14-28-25)22-16-30-31(17-22)23-7-9-27-10-8-23/h3-6,11-12,14-17,23,27H,1,7-10H2,2H3,(H,28,29)/b6-4-,18-5+,19-11- |
| InChIKey | MEHSYQIWAJAAGP-RMELYLOFSA-N |
| XLogP | 4.95 |
| TPSA | 82.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|