C24H20Cl2N6 — CID 174729706
(E)-3-(2,4-dichlorophenyl)-3-[5-(1-piperidin-4-ylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enenitrile (PubChem CID 174729706) has the molecular formula C24H20Cl2N6 and a molecular weight of 463.37 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-3-[5-(1-piperidin-4-ylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enenitrile.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-3-[5-(1-piperidin-4-ylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 174729706 |
| Molecular Formula | C24H20Cl2N6 |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-3-[5-(1-piperidin-4-ylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enenitrile |
| SMILES | N#C/C=C(/c1ccc(Cl)cc1Cl)c1c[nH]c2ncc(-c3cnn(C4CCNCC4)c3)cc12 |
| InChI | InChI=1S/C24H20Cl2N6/c25-17-1-2-20(23(26)10-17)19(3-6-27)22-13-30-24-21(22)9-15(11-29-24)16-12-31-32(14-16)18-4-7-28-8-5-18/h1-3,9-14,18,28H,4-5,7-8H2,(H,29,30)/b19-3- |
| InChIKey | VLIDVMIYJAZPNQ-OQOIWIOPSA-N |
| XLogP | 5.61 |
| TPSA | 82.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|