About ethane;S-(2-methoxybutyl) carbamothioate
ethane;S-(2-methoxybutyl) carbamothioate (PubChem CID 144757844) has the molecular formula C8H19NO2S
and a molecular weight of 193.31 g/mol. Its IUPAC name is ethane;S-(2-methoxybutyl) carbamothioate.
Molecular Properties
| Compound Name | ethane;S-(2-methoxybutyl) carbamothioate |
| PubChem CID | 144757844 |
| Molecular Formula | C8H19NO2S |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | ethane;S-(2-methoxybutyl) carbamothioate |
| SMILES | CC.CCC(CSC(N)=O)OC |
| InChI | InChI=1S/C6H13NO2S.C2H6/c1-3-5(9-2)4-10-6(7)8;1-2/h5H,3-4H2,1-2H3,(H2,7,8);1-2H3 |
| InChIKey | HVBQOFXDWHKOFY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze ethane;S-(2-methoxybutyl) carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;S-(2-methoxybutyl) carbamothioate?
The IUPAC name of ethane;S-(2-methoxybutyl) carbamothioate (CID 144757844) is ethane;S-(2-methoxybutyl) carbamothioate.
What is the SMILES notation for ethane;S-(2-methoxybutyl) carbamothioate?
The canonical SMILES for ethane;S-(2-methoxybutyl) carbamothioate is CC.CCC(CSC(N)=O)OC.
What is the InChIKey of ethane;S-(2-methoxybutyl) carbamothioate?
The InChIKey is HVBQOFXDWHKOFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2S.C2H6/c1-3-5(9-2)4-10-6(7)8;1-2/h5H,3-4H2,1-2H3,(H2,7,8);1-2H3.
What are the key properties of ethane;S-(2-methoxybutyl) carbamothioate?
ethane;S-(2-methoxybutyl) carbamothioate has a molecular weight of 193.31 g/mol, XLogP of 2.25, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;S-(2-methoxybutyl) carbamothioate is sourced from PubChem (CID 144757844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).