C7H15N3O2S2 — CID 27159
S-[3-carbamoylsulfanyl-2-(dimethylamino)propyl] carbamothioate (PubChem CID 27159) has the molecular formula C7H15N3O2S2 and a molecular weight of 237.35 g/mol. Its IUPAC name is S-[3-carbamoylsulfanyl-2-(dimethylamino)propyl] carbamothioate.
| Compound Name | S-[3-carbamoylsulfanyl-2-(dimethylamino)propyl] carbamothioate |
|---|---|
| PubChem CID | 27159 |
| Molecular Formula | C7H15N3O2S2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | S-[3-carbamoylsulfanyl-2-(dimethylamino)propyl] carbamothioate |
| SMILES | CN(C)C(CSC(N)=O)CSC(N)=O |
| InChI | InChI=1S/C7H15N3O2S2/c1-10(2)5(3-13-6(8)11)4-14-7(9)12/h5H,3-4H2,1-2H3,(H2,8,11)(H2,9,12) |
| InChIKey | IRUJZVNXZWPBMU-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|