C5H12NO6S4- — CID 56955919
2-(dimethylamino)-1-sulfonatosulfanyl-3-sulfosulfanylpropane (PubChem CID 56955919) has the molecular formula C5H12NO6S4- and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-(dimethylamino)-1-sulfonatosulfanyl-3-sulfosulfanylpropane.
| Compound Name | 2-(dimethylamino)-1-sulfonatosulfanyl-3-sulfosulfanylpropane |
|---|---|
| PubChem CID | 56955919 |
| Molecular Formula | C5H12NO6S4- |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 309.96 |
| IUPAC Name | 2-(dimethylamino)-1-sulfonatosulfanyl-3-sulfosulfanylpropane |
| SMILES | CN(C)C(CSS(=O)(=O)[O-])CSS(=O)(=O)O |
| InChI | InChI=1S/C5H13NO6S4/c1-6(2)5(3-13-15(7,8)9)4-14-16(10,11)12/h5H,3-4H2,1-2H3,(H,7,8,9)(H,10,11,12)/p-1 |
| InChIKey | PYNKFIVDSJSNGL-UHFFFAOYSA-M |
| XLogP | -0.35 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|