C7H15O4S2- — CID 20749600
2-hydroxy-4,4-dimethyl-1-sulfonatosulfanylpentane (PubChem CID 20749600) has the molecular formula C7H15O4S2- and a molecular weight of 227.33 g/mol. Its IUPAC name is 2-hydroxy-4,4-dimethyl-1-sulfonatosulfanylpentane.
| Compound Name | 2-hydroxy-4,4-dimethyl-1-sulfonatosulfanylpentane |
|---|---|
| PubChem CID | 20749600 |
| Molecular Formula | C7H15O4S2- |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 2-hydroxy-4,4-dimethyl-1-sulfonatosulfanylpentane |
| SMILES | CC(C)(C)CC(O)CSS(=O)(=O)[O-] |
| InChI | InChI=1S/C7H16O4S2/c1-7(2,3)4-6(8)5-12-13(9,10)11/h6,8H,4-5H2,1-3H3,(H,9,10,11)/p-1 |
| InChIKey | AYRVMDKVCIAOTP-UHFFFAOYSA-M |
| XLogP | 0.98 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|