C32H40N4O3S — CID 144758650
1-[3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]-N-methylsulfanylpyrrolidine-2-carboxamide (PubChem CID 144758650) has the molecular formula C32H40N4O3S and a molecular weight of 560.76 g/mol. Its IUPAC name is 1-[3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]-N-methylsulfanylpyrrolidine-2-carboxamide.
| Compound Name | 1-[3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]-N-methylsulfanylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 144758650 |
| Molecular Formula | C32H40N4O3S |
| Molecular Weight | 560.76 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | 1-[3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]-N-methylsulfanylpyrrolidine-2-carboxamide |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CCC(=O)N4CCCC4C(=O)NSC)cc3)nc2)cc1 |
| InChI | InChI=1S/C32H40N4O3S/c1-3-4-5-6-7-21-39-28-17-15-25(16-18-28)27-22-33-31(34-23-27)26-13-10-24(11-14-26)12-19-30(37)36-20-8-9-29(36)32(38)35-40-2/h10-11,13-18,22-23,29H,3-9,12,19-21H2,1-2H3,(H,35,38) |
| InChIKey | XVPCGHSQGZKTCH-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.76 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|