C22H10BrClF5NO3S — CID 144758729
(2,3,4,5,6-pentafluorophenyl) 1-(4-bromo-5-chloro-2-methoxyphenyl)isoquinoline-6-sulfinate (PubChem CID 144758729) has the molecular formula C22H10BrClF5NO3S and a molecular weight of 578.74 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 1-(4-bromo-5-chloro-2-methoxyphenyl)isoquinoline-6-sulfinate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 1-(4-bromo-5-chloro-2-methoxyphenyl)isoquinoline-6-sulfinate |
|---|---|
| PubChem CID | 144758729 |
| Molecular Formula | C22H10BrClF5NO3S |
| Molecular Weight | 578.74 g/mol |
| Exact Mass | 576.92 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 1-(4-bromo-5-chloro-2-methoxyphenyl)isoquinoline-6-sulfinate |
| SMILES | COc1cc(Br)c(Cl)cc1-c1nccc2cc(S(=O)Oc3c(F)c(F)c(F)c(F)c3F)ccc12 |
| InChI | InChI=1S/C22H10BrClF5NO3S/c1-32-15-8-13(23)14(24)7-12(15)21-11-3-2-10(6-9(11)4-5-30-21)34(31)33-22-19(28)17(26)16(25)18(27)20(22)29/h2-8H,1H3 |
| InChIKey | IBYJJJHQRDFVEB-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.74 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|