C20H16NO4+ — CID 144759738
1,2-dimethoxy-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium (PubChem CID 144759738) has the molecular formula C20H16NO4+ and a molecular weight of 334.35 g/mol. Its IUPAC name is 1,2-dimethoxy-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium.
| Compound Name | 1,2-dimethoxy-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium |
|---|---|
| PubChem CID | 144759738 |
| Molecular Formula | C20H16NO4+ |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 1,2-dimethoxy-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium |
| SMILES | COc1ccc2c(c[nH+]c3c4cc5c(cc4ccc23)OCO5)c1OC |
| InChI | InChI=1S/C20H15NO4/c1-22-16-6-5-12-13-4-3-11-7-17-18(25-10-24-17)8-14(11)19(13)21-9-15(12)20(16)23-2/h3-9H,10H2,1-2H3/p+1 |
| InChIKey | JGUNQXPMULKFNY-UHFFFAOYSA-O |
| XLogP | 3.71 |
| TPSA | 51.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|