C9H12BrNO2 — CID 144761306
N-[(3Z)-5-bromo-4-ethoxyhexa-1,3,5-trien-3-yl]formamide (PubChem CID 144761306) has the molecular formula C9H12BrNO2 and a molecular weight of 246.10 g/mol. Its IUPAC name is N-[(3Z)-5-bromo-4-ethoxyhexa-1,3,5-trien-3-yl]formamide.
| Compound Name | N-[(3Z)-5-bromo-4-ethoxyhexa-1,3,5-trien-3-yl]formamide |
|---|---|
| PubChem CID | 144761306 |
| Molecular Formula | C9H12BrNO2 |
| Molecular Weight | 246.10 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | N-[(3Z)-5-bromo-4-ethoxyhexa-1,3,5-trien-3-yl]formamide |
| SMILES | C=C/C(NC=O)=C(/OCC)C(=C)Br |
| InChI | InChI=1S/C9H12BrNO2/c1-4-8(11-6-12)9(7(3)10)13-5-2/h4,6H,1,3,5H2,2H3,(H,11,12)/b9-8- |
| InChIKey | NEUOXVBTFGPYLN-HJWRWDBZSA-N |
| XLogP | 2.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.10 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|