C21H23ClN2O3 — CID 144770596
tert-butyl N-[[7-chloro-5-[4-(methylamino)phenyl]-1-benzofuran-2-yl]methyl]carbamate (PubChem CID 144770596) has the molecular formula C21H23ClN2O3 and a molecular weight of 386.88 g/mol. Its IUPAC name is tert-butyl N-[[7-chloro-5-[4-(methylamino)phenyl]-1-benzofuran-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[7-chloro-5-[4-(methylamino)phenyl]-1-benzofuran-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 144770596 |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | tert-butyl N-[[7-chloro-5-[4-(methylamino)phenyl]-1-benzofuran-2-yl]methyl]carbamate |
| SMILES | CNc1ccc(-c2cc(Cl)c3oc(CNC(=O)OC(C)(C)C)cc3c2)cc1 |
| InChI | InChI=1S/C21H23ClN2O3/c1-21(2,3)27-20(25)24-12-17-10-15-9-14(11-18(22)19(15)26-17)13-5-7-16(23-4)8-6-13/h5-11,23H,12H2,1-4H3,(H,24,25) |
| InChIKey | KNTYOVHSMPOSHN-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |