C31H36F2N2O4Si — CID 163364010
tert-butyl N-[[5-[4-(4,4-difluoropiperidine-1-carbonyl)phenyl]-7-(2-trimethylsilylethynyl)-1-benzofuran-2-yl]methyl]carbamate (PubChem CID 163364010) has the molecular formula C31H36F2N2O4Si and a molecular weight of 566.72 g/mol. Its IUPAC name is tert-butyl N-[[5-[4-(4,4-difluoropiperidine-1-carbonyl)phenyl]-7-(2-trimethylsilylethynyl)-1-benzofuran-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-[4-(4,4-difluoropiperidine-1-carbonyl)phenyl]-7-(2-trimethylsilylethynyl)-1-benzofuran-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 163364010 |
| Molecular Formula | C31H36F2N2O4Si |
| Molecular Weight | 566.72 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | tert-butyl N-[[5-[4-(4,4-difluoropiperidine-1-carbonyl)phenyl]-7-(2-trimethylsilylethynyl)-1-benzofuran-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc2cc(-c3ccc(C(=O)N4CCC(F)(F)CC4)cc3)cc(C#C[Si](C)(C)C)c2o1 |
| InChI | InChI=1S/C31H36F2N2O4Si/c1-30(2,3)39-29(37)34-20-26-19-25-18-24(17-23(27(25)38-26)11-16-40(4,5)6)21-7-9-22(10-8-21)28(36)35-14-12-31(32,33)13-15-35/h7-10,17-19H,12-15,20H2,1-6H3,(H,34,37) |
| InChIKey | IZWOTUINQKPELN-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.72 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|