C27H31F5N2O4 — CID 126601652
tert-butyl N-[3-[3-[4-(4,4-difluoropiperidine-1-carbonyl)phenyl]-5-(trifluoromethyl)phenoxy]propyl]carbamate (PubChem CID 126601652) has the molecular formula C27H31F5N2O4 and a molecular weight of 542.55 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[4-(4,4-difluoropiperidine-1-carbonyl)phenyl]-5-(trifluoromethyl)phenoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[4-(4,4-difluoropiperidine-1-carbonyl)phenyl]-5-(trifluoromethyl)phenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 126601652 |
| Molecular Formula | C27H31F5N2O4 |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | tert-butyl N-[3-[3-[4-(4,4-difluoropiperidine-1-carbonyl)phenyl]-5-(trifluoromethyl)phenoxy]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCOc1cc(-c2ccc(C(=O)N3CCC(F)(F)CC3)cc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H31F5N2O4/c1-25(2,3)38-24(36)33-11-4-14-37-22-16-20(15-21(17-22)27(30,31)32)18-5-7-19(8-6-18)23(35)34-12-9-26(28,29)10-13-34/h5-8,15-17H,4,9-14H2,1-3H3,(H,33,36) |
| InChIKey | IXZWRLGZQCUEOB-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|