C28H31N3O6 — CID 144771198
4-[[4-[1-(4-amino-2-propan-2-yloxyphenyl)ethenylamino]-2-hydroxybenzoyl]amino]-3-propan-2-yloxybenzoic acid (PubChem CID 144771198) has the molecular formula C28H31N3O6 and a molecular weight of 505.57 g/mol. Its IUPAC name is 4-[[4-[1-(4-amino-2-propan-2-yloxyphenyl)ethenylamino]-2-hydroxybenzoyl]amino]-3-propan-2-yloxybenzoic acid.
| Compound Name | 4-[[4-[1-(4-amino-2-propan-2-yloxyphenyl)ethenylamino]-2-hydroxybenzoyl]amino]-3-propan-2-yloxybenzoic acid |
|---|---|
| PubChem CID | 144771198 |
| Molecular Formula | C28H31N3O6 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 4-[[4-[1-(4-amino-2-propan-2-yloxyphenyl)ethenylamino]-2-hydroxybenzoyl]amino]-3-propan-2-yloxybenzoic acid |
| SMILES | C=C(Nc1ccc(C(=O)Nc2ccc(C(=O)O)cc2OC(C)C)c(O)c1)c1ccc(N)cc1OC(C)C |
| InChI | InChI=1S/C28H31N3O6/c1-15(2)36-25-13-19(29)7-9-21(25)17(5)30-20-8-10-22(24(32)14-20)27(33)31-23-11-6-18(28(34)35)12-26(23)37-16(3)4/h6-16,30,32H,5,29H2,1-4H3,(H,31,33)(H,34,35) |
| InChIKey | DWXQBRZDHLGCGN-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|