C26H35N3O4 — CID 53496264
4-[[(Z)-1-(4-amino-2-propan-2-yloxyphenyl)-5-methyl-1-oxohex-2-en-3-yl]amino]-2-propan-2-yloxybenzamide (PubChem CID 53496264) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is 4-[[(Z)-1-(4-amino-2-propan-2-yloxyphenyl)-5-methyl-1-oxohex-2-en-3-yl]amino]-2-propan-2-yloxybenzamide.
| Compound Name | 4-[[(Z)-1-(4-amino-2-propan-2-yloxyphenyl)-5-methyl-1-oxohex-2-en-3-yl]amino]-2-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 53496264 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | 4-[[(Z)-1-(4-amino-2-propan-2-yloxyphenyl)-5-methyl-1-oxohex-2-en-3-yl]amino]-2-propan-2-yloxybenzamide |
| SMILES | CC(C)C/C(=C/C(=O)c1ccc(N)cc1OC(C)C)Nc1ccc(C(N)=O)c(OC(C)C)c1 |
| InChI | InChI=1S/C26H35N3O4/c1-15(2)11-20(13-23(30)21-9-7-18(27)12-24(21)32-16(3)4)29-19-8-10-22(26(28)31)25(14-19)33-17(5)6/h7-10,12-17,29H,11,27H2,1-6H3,(H2,28,31)/b20-13- |
| InChIKey | MKOBHOMUBUHFKK-MOSHPQCFSA-N |
| XLogP | 5.17 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|