C61H76O4 — CID 144772167
1,2-bis(ethenyl)-3-[[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]methyl]benzene;2-[2-[1-(4-butylphenoxy)ethoxy]ethoxy]-1,3-diphenylbenzene;ethane (PubChem CID 144772167) has the molecular formula C61H76O4 and a molecular weight of 873.28 g/mol. Its IUPAC name is 1,2-bis(ethenyl)-3-[[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]methyl]benzene;2-[2-[1-(4-butylphenoxy)ethoxy]ethoxy]-1,3-diphenylbenzene;ethane.
| Compound Name | 1,2-bis(ethenyl)-3-[[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]methyl]benzene;2-[2-[1-(4-butylphenoxy)ethoxy]ethoxy]-1,3-diphenylbenzene;ethane |
|---|---|
| PubChem CID | 144772167 |
| Molecular Formula | C61H76O4 |
| Molecular Weight | 873.28 g/mol |
| Exact Mass | 872.57 |
| IUPAC Name | 1,2-bis(ethenyl)-3-[[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]methyl]benzene;2-[2-[1-(4-butylphenoxy)ethoxy]ethoxy]-1,3-diphenylbenzene;ethane |
| SMILES | C=Cc1cccc(COc2ccc(C(CC(C)(C)C)C(C)(C)C)cc2)c1C=C.CC.CCCCc1ccc(OC(C)OCCOc2c(-c3ccccc3)cccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C32H34O3.C27H36O.C2H6/c1-3-4-12-26-19-21-29(22-20-26)35-25(2)33-23-24-34-32-30(27-13-7-5-8-14-27)17-11-18-31(32)28-15-9-6-10-16-28;1-9-20-12-11-13-22(24(20)10-2)19-28-23-16-14-21(15-17-23)25(27(6,7)8)18-26(3,4)5;1-2/h5-11,13-22,25H,3-4,12,23-24H2,1-2H3;9-17,25H,1-2,18-19H2,3-8H3;1-2H3 |
| InChIKey | MFKSAADDLKMBRQ-UHFFFAOYSA-N |
| XLogP | 17.33 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.28 |
| LogP ≤ 5 | 17.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|