C13H22O4 — CID 144773974
(4E,8E)-12-hydroperoxy-12-methoxydodeca-4,8-dienal (PubChem CID 144773974) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is (4E,8E)-12-hydroperoxy-12-methoxydodeca-4,8-dienal.
| Compound Name | (4E,8E)-12-hydroperoxy-12-methoxydodeca-4,8-dienal |
|---|---|
| PubChem CID | 144773974 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (4E,8E)-12-hydroperoxy-12-methoxydodeca-4,8-dienal |
| SMILES | COC(CC/C=C/CC/C=C/CCC=O)OO |
| InChI | InChI=1S/C13H22O4/c1-16-13(17-15)11-9-7-5-3-2-4-6-8-10-12-14/h4-7,12-13,15H,2-3,8-11H2,1H3/b6-4+,7-5+ |
| InChIKey | VRLGRWBOBPQFGA-YDFGWWAZSA-N |
| XLogP | 3.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|