C25H33N — CID 144776232
(2E)-N-methyl-3-[4-(4-phenylheptyl)phenyl]penta-2,4-dien-2-amine (PubChem CID 144776232) has the molecular formula C25H33N and a molecular weight of 347.55 g/mol. Its IUPAC name is (2E)-N-methyl-3-[4-(4-phenylheptyl)phenyl]penta-2,4-dien-2-amine.
| Compound Name | (2E)-N-methyl-3-[4-(4-phenylheptyl)phenyl]penta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 144776232 |
| Molecular Formula | C25H33N |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | (2E)-N-methyl-3-[4-(4-phenylheptyl)phenyl]penta-2,4-dien-2-amine |
| SMILES | C=C/C(=C(/C)NC)c1ccc(CCCC(CCC)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H33N/c1-5-11-22(23-13-8-7-9-14-23)15-10-12-21-16-18-24(19-17-21)25(6-2)20(3)26-4/h6-9,13-14,16-19,22,26H,2,5,10-12,15H2,1,3-4H3/b25-20+ |
| InChIKey | VMVGPGSMYYDRBU-LKUDQCMESA-N |
| XLogP | 6.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|