C36H56N2 — CID 174122606
(3S)-3-[4-(9-ethyliminoundec-10-enyl)phenyl]-11-phenylundecan-1-amine (PubChem CID 174122606) has the molecular formula C36H56N2 and a molecular weight of 516.86 g/mol. Its IUPAC name is (3S)-3-[4-(9-ethyliminoundec-10-enyl)phenyl]-11-phenylundecan-1-amine.
| Compound Name | (3S)-3-[4-(9-ethyliminoundec-10-enyl)phenyl]-11-phenylundecan-1-amine |
|---|---|
| PubChem CID | 174122606 |
| Molecular Formula | C36H56N2 |
| Molecular Weight | 516.86 g/mol |
| Exact Mass | 516.44 |
| IUPAC Name | (3S)-3-[4-(9-ethyliminoundec-10-enyl)phenyl]-11-phenylundecan-1-amine |
| SMILES | C=C/C(CCCCCCCCc1ccc([C@H](CCN)CCCCCCCCc2ccccc2)cc1)=N\CC |
| InChI | InChI=1S/C36H56N2/c1-3-36(38-4-2)25-19-12-8-6-10-15-23-33-26-28-35(29-27-33)34(30-31-37)24-18-11-7-5-9-14-20-32-21-16-13-17-22-32/h3,13,16-17,21-22,26-29,34H,1,4-12,14-15,18-20,23-25,30-31,37H2,2H3/b38-36+/t34-/m0/s1 |
| InChIKey | KYFRUFIGOITPKU-YMWYSREHSA-N |
| XLogP | 10.01 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.86 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|