C25H38S — CID 144776517
(3Z,5E)-9-(2,4-ditert-butylphenyl)-6-methyl-2-methylidenenona-3,5-diene-1-thiol (PubChem CID 144776517) has the molecular formula C25H38S and a molecular weight of 370.65 g/mol. Its IUPAC name is (3Z,5E)-9-(2,4-ditert-butylphenyl)-6-methyl-2-methylidenenona-3,5-diene-1-thiol.
| Compound Name | (3Z,5E)-9-(2,4-ditert-butylphenyl)-6-methyl-2-methylidenenona-3,5-diene-1-thiol |
|---|---|
| PubChem CID | 144776517 |
| Molecular Formula | C25H38S |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | (3Z,5E)-9-(2,4-ditert-butylphenyl)-6-methyl-2-methylidenenona-3,5-diene-1-thiol |
| SMILES | C=C(/C=C\C=C(/C)CCCc1ccc(C(C)(C)C)cc1C(C)(C)C)CS |
| InChI | InChI=1S/C25H38S/c1-19(11-9-13-20(2)18-26)12-10-14-21-15-16-22(24(3,4)5)17-23(21)25(6,7)8/h9,11,13,15-17,26H,2,10,12,14,18H2,1,3-8H3/b13-9-,19-11+ |
| InChIKey | PSCCXYVNFMRIHL-FKDPSPLQSA-N |
| XLogP | 7.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|