C22H26O — CID 144776567
1-[3-[(E)-1-(2,5-dimethylphenyl)prop-1-en-2-yl]-5-propylphenyl]ethanone (PubChem CID 144776567) has the molecular formula C22H26O and a molecular weight of 306.45 g/mol. Its IUPAC name is 1-[3-[(E)-1-(2,5-dimethylphenyl)prop-1-en-2-yl]-5-propylphenyl]ethanone.
| Compound Name | 1-[3-[(E)-1-(2,5-dimethylphenyl)prop-1-en-2-yl]-5-propylphenyl]ethanone |
|---|---|
| PubChem CID | 144776567 |
| Molecular Formula | C22H26O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 1-[3-[(E)-1-(2,5-dimethylphenyl)prop-1-en-2-yl]-5-propylphenyl]ethanone |
| SMILES | CCCc1cc(C(C)=O)cc(/C(C)=C/c2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C22H26O/c1-6-7-19-12-21(14-22(13-19)18(5)23)17(4)11-20-10-15(2)8-9-16(20)3/h8-14H,6-7H2,1-5H3/b17-11+ |
| InChIKey | LPNNCCFIEDUWFY-GZTJUZNOSA-N |
| XLogP | 6.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|