C19H25N — CID 144777782
(3R)-1-ethyl-3-methyl-5-phenyl-2,3-dihydro-1H-indene;methanamine (PubChem CID 144777782) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is (3R)-1-ethyl-3-methyl-5-phenyl-2,3-dihydro-1H-indene;methanamine.
| Compound Name | (3R)-1-ethyl-3-methyl-5-phenyl-2,3-dihydro-1H-indene;methanamine |
|---|---|
| PubChem CID | 144777782 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | (3R)-1-ethyl-3-methyl-5-phenyl-2,3-dihydro-1H-indene;methanamine |
| SMILES | CCC1C[C@@H](C)c2cc(-c3ccccc3)ccc21.CN |
| InChI | InChI=1S/C18H20.CH5N/c1-3-14-11-13(2)18-12-16(9-10-17(14)18)15-7-5-4-6-8-15;1-2/h4-10,12-14H,3,11H2,1-2H3;2H2,1H3/t13-,14?;/m1./s1 |
| InChIKey | DKPJMSUBIIKIQZ-JRLNIEDVSA-N |
| XLogP | 4.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |