C23H28N4O2S — CID 144783805
methanethiohydrazide;2-[[5-(4-methoxyphenyl)-6-methyl-2-pyridinyl]oxymethyl]-N,3-dimethylaniline (PubChem CID 144783805) has the molecular formula C23H28N4O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is methanethiohydrazide;2-[[5-(4-methoxyphenyl)-6-methyl-2-pyridinyl]oxymethyl]-N,3-dimethylaniline.
| Compound Name | methanethiohydrazide;2-[[5-(4-methoxyphenyl)-6-methyl-2-pyridinyl]oxymethyl]-N,3-dimethylaniline |
|---|---|
| PubChem CID | 144783805 |
| Molecular Formula | C23H28N4O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | methanethiohydrazide;2-[[5-(4-methoxyphenyl)-6-methyl-2-pyridinyl]oxymethyl]-N,3-dimethylaniline |
| SMILES | CNc1cccc(C)c1COc1ccc(-c2ccc(OC)cc2)c(C)n1.NNC=S |
| InChI | InChI=1S/C22H24N2O2.CH4N2S/c1-15-6-5-7-21(23-3)20(15)14-26-22-13-12-19(16(2)24-22)17-8-10-18(25-4)11-9-17;2-3-1-4/h5-13,23H,14H2,1-4H3;1H,2H2,(H,3,4) |
| InChIKey | RUXYVKVRDZTHER-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|