C13H11Br2NO — CID 144788235
N-(2,4-dibromocyclohexa-1,3-dien-1-yl)benzamide (PubChem CID 144788235) has the molecular formula C13H11Br2NO and a molecular weight of 357.05 g/mol. Its IUPAC name is N-(2,4-dibromocyclohexa-1,3-dien-1-yl)benzamide.
| Compound Name | N-(2,4-dibromocyclohexa-1,3-dien-1-yl)benzamide |
|---|---|
| PubChem CID | 144788235 |
| Molecular Formula | C13H11Br2NO |
| Molecular Weight | 357.05 g/mol |
| Exact Mass | 354.92 |
| IUPAC Name | N-(2,4-dibromocyclohexa-1,3-dien-1-yl)benzamide |
| SMILES | O=C(NC1=C(Br)C=C(Br)CC1)c1ccccc1 |
| InChI | InChI=1S/C13H11Br2NO/c14-10-6-7-12(11(15)8-10)16-13(17)9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H,16,17) |
| InChIKey | TVERBZZMMKECQO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.05 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |