About 2-hydroxycyclohexa-1,3-diene-1-carbonitrile
2-hydroxycyclohexa-1,3-diene-1-carbonitrile (PubChem CID 144789069) has the molecular formula C7H7NO
and a molecular weight of 121.14 g/mol. Its IUPAC name is 2-hydroxycyclohexa-1,3-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 2-hydroxycyclohexa-1,3-diene-1-carbonitrile |
| PubChem CID | 144789069 |
| Molecular Formula | C7H7NO |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.05 |
| IUPAC Name | 2-hydroxycyclohexa-1,3-diene-1-carbonitrile |
| SMILES | N#CC1=C(O)C=CCC1 |
| InChI | InChI=1S/C7H7NO/c8-5-6-3-1-2-4-7(6)9/h2,4,9H,1,3H2 |
| InChIKey | KEGGXWDJCCBYSA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-hydroxycyclohexa-1,3-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxycyclohexa-1,3-diene-1-carbonitrile?
The IUPAC name of 2-hydroxycyclohexa-1,3-diene-1-carbonitrile (CID 144789069) is 2-hydroxycyclohexa-1,3-diene-1-carbonitrile.
What is the SMILES notation for 2-hydroxycyclohexa-1,3-diene-1-carbonitrile?
The canonical SMILES for 2-hydroxycyclohexa-1,3-diene-1-carbonitrile is N#CC1=C(O)C=CCC1.
What is the InChIKey of 2-hydroxycyclohexa-1,3-diene-1-carbonitrile?
The InChIKey is KEGGXWDJCCBYSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO/c8-5-6-3-1-2-4-7(6)9/h2,4,9H,1,3H2.
What are the key properties of 2-hydroxycyclohexa-1,3-diene-1-carbonitrile?
2-hydroxycyclohexa-1,3-diene-1-carbonitrile has a molecular weight of 121.14 g/mol, XLogP of 1.67, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxycyclohexa-1,3-diene-1-carbonitrile is sourced from PubChem (CID 144789069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).