About 4-hydroxycyclohepta-1,3,5-triene-1-carbonitrile
4-hydroxycyclohepta-1,3,5-triene-1-carbonitrile (PubChem CID 142917197) has the molecular formula C8H7NO
and a molecular weight of 133.15 g/mol. Its IUPAC name is 4-hydroxycyclohepta-1,3,5-triene-1-carbonitrile.
Analyze 4-hydroxycyclohepta-1,3,5-triene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxycyclohepta-1,3,5-triene-1-carbonitrile?
The IUPAC name of 4-hydroxycyclohepta-1,3,5-triene-1-carbonitrile (CID 142917197) is 4-hydroxycyclohepta-1,3,5-triene-1-carbonitrile.
What is the SMILES notation for 4-hydroxycyclohepta-1,3,5-triene-1-carbonitrile?
The canonical SMILES for 4-hydroxycyclohepta-1,3,5-triene-1-carbonitrile is N#CC1=CC=C(O)C=CC1.
What is the InChIKey of 4-hydroxycyclohepta-1,3,5-triene-1-carbonitrile?
The InChIKey is DQLOZAPEMCGBEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO/c9-6-7-2-1-3-8(10)5-4-7/h1,3-5,10H,2H2.
What are the key properties of 4-hydroxycyclohepta-1,3,5-triene-1-carbonitrile?
4-hydroxycyclohepta-1,3,5-triene-1-carbonitrile has a molecular weight of 133.15 g/mol, XLogP of 1.84, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxycyclohepta-1,3,5-triene-1-carbonitrile is sourced from PubChem (CID 142917197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).