C29H43NO6 — CID 144789343
tert-butyl N-[3-[4-formyl-2,6-bis(hex-5-ynoxy)phenyl]propyl]carbamate;methoxymethane (PubChem CID 144789343) has the molecular formula C29H43NO6 and a molecular weight of 501.66 g/mol. Its IUPAC name is tert-butyl N-[3-[4-formyl-2,6-bis(hex-5-ynoxy)phenyl]propyl]carbamate;methoxymethane.
| Compound Name | tert-butyl N-[3-[4-formyl-2,6-bis(hex-5-ynoxy)phenyl]propyl]carbamate;methoxymethane |
|---|---|
| PubChem CID | 144789343 |
| Molecular Formula | C29H43NO6 |
| Molecular Weight | 501.66 g/mol |
| Exact Mass | 501.31 |
| IUPAC Name | tert-butyl N-[3-[4-formyl-2,6-bis(hex-5-ynoxy)phenyl]propyl]carbamate;methoxymethane |
| SMILES | C#CCCCCOc1cc(C=O)cc(OCCCCC#C)c1CCCNC(=O)OC(C)(C)C.COC |
| InChI | InChI=1S/C27H37NO5.C2H6O/c1-6-8-10-12-17-31-24-19-22(21-29)20-25(32-18-13-11-9-7-2)23(24)15-14-16-28-26(30)33-27(3,4)5;1-3-2/h1-2,19-21H,8-18H2,3-5H3,(H,28,30);1-2H3 |
| InChIKey | LTJAKHMVIBPVBR-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.66 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|