C14H17N3O6 — CID 144789427
(3S)-3-[(2-formamidoacetyl)amino]-4-(4-methoxyanilino)-4-oxobutanoic acid (PubChem CID 144789427) has the molecular formula C14H17N3O6 and a molecular weight of 323.31 g/mol. Its IUPAC name is (3S)-3-[(2-formamidoacetyl)amino]-4-(4-methoxyanilino)-4-oxobutanoic acid.
| Compound Name | (3S)-3-[(2-formamidoacetyl)amino]-4-(4-methoxyanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 144789427 |
| Molecular Formula | C14H17N3O6 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (3S)-3-[(2-formamidoacetyl)amino]-4-(4-methoxyanilino)-4-oxobutanoic acid |
| SMILES | COc1ccc(NC(=O)[C@H](CC(=O)O)NC(=O)CNC=O)cc1 |
| InChI | InChI=1S/C14H17N3O6/c1-23-10-4-2-9(3-5-10)16-14(22)11(6-13(20)21)17-12(19)7-15-8-18/h2-5,8,11H,6-7H2,1H3,(H,15,18)(H,16,22)(H,17,19)(H,20,21)/t11-/m0/s1 |
| InChIKey | RKYYORSPBCDVLA-NSHDSACASA-N |
| XLogP | -0.66 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|