C27H25NOS — CID 144790224
1-[4-[4-[4-[[(2E,4Z)-hepta-2,4,6-trien-3-yl]sulfanylamino]phenyl]phenyl]phenyl]ethanone (PubChem CID 144790224) has the molecular formula C27H25NOS and a molecular weight of 411.57 g/mol. Its IUPAC name is 1-[4-[4-[4-[[(2E,4Z)-hepta-2,4,6-trien-3-yl]sulfanylamino]phenyl]phenyl]phenyl]ethanone.
| Compound Name | 1-[4-[4-[4-[[(2E,4Z)-hepta-2,4,6-trien-3-yl]sulfanylamino]phenyl]phenyl]phenyl]ethanone |
|---|---|
| PubChem CID | 144790224 |
| Molecular Formula | C27H25NOS |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 1-[4-[4-[4-[[(2E,4Z)-hepta-2,4,6-trien-3-yl]sulfanylamino]phenyl]phenyl]phenyl]ethanone |
| SMILES | C=C/C=C\C(=C/C)SNc1ccc(-c2ccc(-c3ccc(C(C)=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C27H25NOS/c1-4-6-7-27(5-2)30-28-26-18-16-25(17-19-26)24-14-12-23(13-15-24)22-10-8-21(9-11-22)20(3)29/h4-19,28H,1H2,2-3H3/b7-6-,27-5+ |
| InChIKey | AIECAYMWJRSRRZ-HHSYEQHYSA-N |
| XLogP | 7.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|