C26H24N2O2 — CID 169241795
1-[4-[3-acetyl-4-[[(2E,4Z)-hepta-2,4,6-trien-3-yl]amino]quinolin-6-yl]phenyl]ethanone (PubChem CID 169241795) has the molecular formula C26H24N2O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is 1-[4-[3-acetyl-4-[[(2E,4Z)-hepta-2,4,6-trien-3-yl]amino]quinolin-6-yl]phenyl]ethanone.
| Compound Name | 1-[4-[3-acetyl-4-[[(2E,4Z)-hepta-2,4,6-trien-3-yl]amino]quinolin-6-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 169241795 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 1-[4-[3-acetyl-4-[[(2E,4Z)-hepta-2,4,6-trien-3-yl]amino]quinolin-6-yl]phenyl]ethanone |
| SMILES | C=C/C=C\C(=C/C)Nc1c(C(C)=O)cnc2ccc(-c3ccc(C(C)=O)cc3)cc12 |
| InChI | InChI=1S/C26H24N2O2/c1-5-7-8-22(6-2)28-26-23-15-21(20-11-9-19(10-12-20)17(3)29)13-14-25(23)27-16-24(26)18(4)30/h5-16H,1H2,2-4H3,(H,27,28)/b8-7-,22-6+ |
| InChIKey | ZHDQGWNXZHSZGW-GHGRUSQESA-N |
| XLogP | 6.36 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|