C27H18F3N3O — CID 164817845
(E)-4-[6-(4-isocyanophenyl)-4-[3-(trifluoromethyl)anilino]quinolin-3-yl]but-3-en-2-one (PubChem CID 164817845) has the molecular formula C27H18F3N3O and a molecular weight of 457.46 g/mol. Its IUPAC name is (E)-4-[6-(4-isocyanophenyl)-4-[3-(trifluoromethyl)anilino]quinolin-3-yl]but-3-en-2-one.
| Compound Name | (E)-4-[6-(4-isocyanophenyl)-4-[3-(trifluoromethyl)anilino]quinolin-3-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 164817845 |
| Molecular Formula | C27H18F3N3O |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | (E)-4-[6-(4-isocyanophenyl)-4-[3-(trifluoromethyl)anilino]quinolin-3-yl]but-3-en-2-one |
| SMILES | [C-]#[N+]c1ccc(-c2ccc3ncc(/C=C/C(C)=O)c(Nc4cccc(C(F)(F)F)c4)c3c2)cc1 |
| InChI | InChI=1S/C27H18F3N3O/c1-17(34)6-7-20-16-32-25-13-10-19(18-8-11-22(31-2)12-9-18)14-24(25)26(20)33-23-5-3-4-21(15-23)27(28,29)30/h3-16H,1H3,(H,32,33)/b7-6+ |
| InChIKey | FZGQQNUZNSYHMK-VOTSOKGWSA-N |
| XLogP | 7.82 |
| TPSA | 46.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|