C29H20F3N3O — CID 155249713
(E)-4-[6-quinolin-3-yl-4-[3-(trifluoromethyl)anilino]quinolin-3-yl]but-3-en-2-one (PubChem CID 155249713) has the molecular formula C29H20F3N3O and a molecular weight of 483.49 g/mol. Its IUPAC name is (E)-4-[6-quinolin-3-yl-4-[3-(trifluoromethyl)anilino]quinolin-3-yl]but-3-en-2-one.
| Compound Name | (E)-4-[6-quinolin-3-yl-4-[3-(trifluoromethyl)anilino]quinolin-3-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 155249713 |
| Molecular Formula | C29H20F3N3O |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | (E)-4-[6-quinolin-3-yl-4-[3-(trifluoromethyl)anilino]quinolin-3-yl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1cnc2ccc(-c3cnc4ccccc4c3)cc2c1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H20F3N3O/c1-18(36)9-10-21-16-34-27-12-11-19(22-13-20-5-2-3-8-26(20)33-17-22)14-25(27)28(21)35-24-7-4-6-23(15-24)29(30,31)32/h2-17H,1H3,(H,34,35)/b10-9+ |
| InChIKey | NUCRMPNQHMKSGJ-MDZDMXLPSA-N |
| XLogP | 7.81 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|