C32H25F3N4O2 — CID 175187592
(E)-4-[6-[3-(phenylmethoxyamino)-2-pyridinyl]-4-[3-(trifluoromethyl)anilino]quinolin-3-yl]but-3-en-2-one (PubChem CID 175187592) has the molecular formula C32H25F3N4O2 and a molecular weight of 554.57 g/mol. Its IUPAC name is (E)-4-[6-[3-(phenylmethoxyamino)-2-pyridinyl]-4-[3-(trifluoromethyl)anilino]quinolin-3-yl]but-3-en-2-one.
| Compound Name | (E)-4-[6-[3-(phenylmethoxyamino)-2-pyridinyl]-4-[3-(trifluoromethyl)anilino]quinolin-3-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 175187592 |
| Molecular Formula | C32H25F3N4O2 |
| Molecular Weight | 554.57 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | (E)-4-[6-[3-(phenylmethoxyamino)-2-pyridinyl]-4-[3-(trifluoromethyl)anilino]quinolin-3-yl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1cnc2ccc(-c3ncccc3NOCc3ccccc3)cc2c1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H25F3N4O2/c1-21(40)12-13-24-19-37-28-15-14-23(17-27(28)30(24)38-26-10-5-9-25(18-26)32(33,34)35)31-29(11-6-16-36-31)39-41-20-22-7-3-2-4-8-22/h2-19,39H,20H2,1H3,(H,37,38)/b13-12+ |
| InChIKey | DRZNDVXPDLONOD-OUKQBFOZSA-N |
| XLogP | 8.21 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.57 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|